C18H25NO3 — CID 87868936
2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-dicarbaldehyde (PubChem CID 87868936) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-dicarbaldehyde.
| Compound Name | 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-dicarbaldehyde |
|---|---|
| PubChem CID | 87868936 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | 2-[(dimethylamino)methyl]-1-(3-methoxyphenyl)cyclohexane-1,4-dicarbaldehyde |
| SMILES | COc1cccc(C2(C=O)CCC(C=O)CC2CN(C)C)c1 |
| InChI | InChI=1S/C18H25NO3/c1-19(2)11-16-9-14(12-20)7-8-18(16,13-21)15-5-4-6-17(10-15)22-3/h4-6,10,12-14,16H,7-9,11H2,1-3H3 |
| InChIKey | FAASJVABGRVMRF-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|