C24H31N3O — CID 135240667
3-[3-[(dimethylamino)methyl]-4-[(3S)-3-hydroxy-3-phenylpropyl]piperidin-4-yl]benzonitrile (PubChem CID 135240667) has the molecular formula C24H31N3O and a molecular weight of 377.53 g/mol. Its IUPAC name is 3-[3-[(dimethylamino)methyl]-4-[(3S)-3-hydroxy-3-phenylpropyl]piperidin-4-yl]benzonitrile.
| Compound Name | 3-[3-[(dimethylamino)methyl]-4-[(3S)-3-hydroxy-3-phenylpropyl]piperidin-4-yl]benzonitrile |
|---|---|
| PubChem CID | 135240667 |
| Molecular Formula | C24H31N3O |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | 3-[3-[(dimethylamino)methyl]-4-[(3S)-3-hydroxy-3-phenylpropyl]piperidin-4-yl]benzonitrile |
| SMILES | CN(C)CC1CNCCC1(CC[C@H](O)c1ccccc1)c1cccc(C#N)c1 |
| InChI | InChI=1S/C24H31N3O/c1-27(2)18-22-17-26-14-13-24(22,21-10-6-7-19(15-21)16-25)12-11-23(28)20-8-4-3-5-9-20/h3-10,15,22-23,26,28H,11-14,17-18H2,1-2H3/t22?,23-,24?/m0/s1 |
| InChIKey | NGWMYAJGLKWRRO-WLXPTCNVSA-N |
| XLogP | 3.48 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |