About (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate
(Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate (PubChem CID 174479178) has the molecular formula C39H57O5P
and a molecular weight of 636.85 g/mol. Its IUPAC name is (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate.
Molecular Properties
| Compound Name | (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate |
| PubChem CID | 174479178 |
| Molecular Formula | C39H57O5P |
| Molecular Weight | 636.85 g/mol |
| Exact Mass | 636.39 |
| IUPAC Name | (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate |
| SMILES | CCCCCCCC/C=C\CCCCCCCCO.Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H21O4P.C18H36O/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h4-15H,1-3H3;9-10,19H,2-8,11-18H2,1H3/b;10-9- |
| InChIKey | BANCUXJSHJTLRC-SVMKZPJVSA-N |
| XLogP | 12.27 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 636.85 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate?
The IUPAC name of (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate (CID 174479178) is (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate.
What is the SMILES notation for (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate?
The canonical SMILES for (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate is CCCCCCCC/C=C\CCCCCCCCO.Cc1ccc(OP(=O)(Oc2ccc(C)cc2)Oc2ccc(C)cc2)cc1.
What is the InChIKey of (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate?
The InChIKey is BANCUXJSHJTLRC-SVMKZPJVSA-N. The full InChI is InChI=1S/C21H21O4P.C18H36O/c1-16-4-10-19(11-5-16)23-26(22,24-20-12-6-17(2)7-13-20)25-21-14-8-18(3)9-15-21;1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19/h4-15H,1-3H3;9-10,19H,2-8,11-18H2,1H3/b;10-9-.
What are the key properties of (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate?
(Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate has a molecular weight of 636.85 g/mol, XLogP of 12.27, 21 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-en-1-ol;tris(4-methylphenyl) phosphate is sourced from PubChem (CID 174479178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).