About 1,8-diaminooctan-2-yl formate
1,8-diaminooctan-2-yl formate (PubChem CID 174479369) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is 1,8-diaminooctan-2-yl formate.
Molecular Properties
| Compound Name | 1,8-diaminooctan-2-yl formate |
| PubChem CID | 174479369 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | 1,8-diaminooctan-2-yl formate |
| SMILES | NCCCCCCC(CN)OC=O |
| InChI | InChI=1S/C9H20N2O2/c10-6-4-2-1-3-5-9(7-11)13-8-12/h8-9H,1-7,10-11H2 |
| InChIKey | UQXZOPPRAVJRKR-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 78.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,8-diaminooctan-2-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,8-diaminooctan-2-yl formate?
The IUPAC name of 1,8-diaminooctan-2-yl formate (CID 174479369) is 1,8-diaminooctan-2-yl formate.
What is the SMILES notation for 1,8-diaminooctan-2-yl formate?
The canonical SMILES for 1,8-diaminooctan-2-yl formate is NCCCCCCC(CN)OC=O.
What is the InChIKey of 1,8-diaminooctan-2-yl formate?
The InChIKey is UQXZOPPRAVJRKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H20N2O2/c10-6-4-2-1-3-5-9(7-11)13-8-12/h8-9H,1-7,10-11H2.
What are the key properties of 1,8-diaminooctan-2-yl formate?
1,8-diaminooctan-2-yl formate has a molecular weight of 188.27 g/mol, XLogP of 0.40, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,8-diaminooctan-2-yl formate is sourced from PubChem (CID 174479369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).