C15H30Cl2N2Ti — CID 174479679
dichlorotitanium;1,1-dicyclohexylpropane-1,3-diamine (PubChem CID 174479679) has the molecular formula C15H30Cl2N2Ti and a molecular weight of 357.19 g/mol. Its IUPAC name is dichlorotitanium;1,1-dicyclohexylpropane-1,3-diamine.
| Compound Name | dichlorotitanium;1,1-dicyclohexylpropane-1,3-diamine |
|---|---|
| PubChem CID | 174479679 |
| Molecular Formula | C15H30Cl2N2Ti |
| Molecular Weight | 357.19 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | dichlorotitanium;1,1-dicyclohexylpropane-1,3-diamine |
| SMILES | Cl[Ti]Cl.NCCC(N)(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C15H30N2.2ClH.Ti/c16-12-11-15(17,13-7-3-1-4-8-13)14-9-5-2-6-10-14;;;/h13-14H,1-12,16-17H2;2*1H;/q;;;+2/p-2 |
| InChIKey | PQGYMYJPTHPXDW-UHFFFAOYSA-L |
| XLogP | 4.57 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.19 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |