About copper;1,1-di(cyclooctyl)ethane-1,2-diamine
copper;1,1-di(cyclooctyl)ethane-1,2-diamine (PubChem CID 118577975) has the molecular formula C18H36CuN2
and a molecular weight of 344.05 g/mol. Its IUPAC name is copper;1,1-di(cyclooctyl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | copper;1,1-di(cyclooctyl)ethane-1,2-diamine |
| PubChem CID | 118577975 |
| Molecular Formula | C18H36CuN2 |
| Molecular Weight | 344.05 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | copper;1,1-di(cyclooctyl)ethane-1,2-diamine |
| SMILES | NCC(N)(C1CCCCCCC1)C1CCCCCCC1.[Cu] |
| InChI | InChI=1S/C18H36N2.Cu/c19-15-18(20,16-11-7-3-1-4-8-12-16)17-13-9-5-2-6-10-14-17;/h16-17H,1-15,19-20H2; |
| InChIKey | COWGYNUJKRXKKG-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.05 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze copper;1,1-di(cyclooctyl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper;1,1-di(cyclooctyl)ethane-1,2-diamine?
The IUPAC name of copper;1,1-di(cyclooctyl)ethane-1,2-diamine (CID 118577975) is copper;1,1-di(cyclooctyl)ethane-1,2-diamine.
What is the SMILES notation for copper;1,1-di(cyclooctyl)ethane-1,2-diamine?
The canonical SMILES for copper;1,1-di(cyclooctyl)ethane-1,2-diamine is NCC(N)(C1CCCCCCC1)C1CCCCCCC1.[Cu].
What is the InChIKey of copper;1,1-di(cyclooctyl)ethane-1,2-diamine?
The InChIKey is COWGYNUJKRXKKG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2.Cu/c19-15-18(20,16-11-7-3-1-4-8-12-16)17-13-9-5-2-6-10-14-17;/h16-17H,1-15,19-20H2;.
What are the key properties of copper;1,1-di(cyclooctyl)ethane-1,2-diamine?
copper;1,1-di(cyclooctyl)ethane-1,2-diamine has a molecular weight of 344.05 g/mol, XLogP of 4.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for copper;1,1-di(cyclooctyl)ethane-1,2-diamine is sourced from PubChem (CID 118577975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).