C11H18O6Si — CID 174480763
(Z)-3-methyl-4-oxo-4-(1-oxo-1-trimethylsilyloxypropan-2-yl)oxybut-2-enoic acid (PubChem CID 174480763) has the molecular formula C11H18O6Si and a molecular weight of 274.34 g/mol. Its IUPAC name is (Z)-3-methyl-4-oxo-4-(1-oxo-1-trimethylsilyloxypropan-2-yl)oxybut-2-enoic acid.
| Compound Name | (Z)-3-methyl-4-oxo-4-(1-oxo-1-trimethylsilyloxypropan-2-yl)oxybut-2-enoic acid |
|---|---|
| PubChem CID | 174480763 |
| Molecular Formula | C11H18O6Si |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (Z)-3-methyl-4-oxo-4-(1-oxo-1-trimethylsilyloxypropan-2-yl)oxybut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)OC(C)C(=O)O[Si](C)(C)C |
| InChI | InChI=1S/C11H18O6Si/c1-7(6-9(12)13)10(14)16-8(2)11(15)17-18(3,4)5/h6,8H,1-5H3,(H,12,13)/b7-6- |
| InChIKey | NDDQIJSLMFRPJH-SREVYHEPSA-N |
| XLogP | 1.33 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|