C22H26N2O5 — CID 174481147
1,5-bis(4-ethoxy-2-pyridinyl)pentane-1,3,5-tricarbaldehyde (PubChem CID 174481147) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1,5-bis(4-ethoxy-2-pyridinyl)pentane-1,3,5-tricarbaldehyde.
| Compound Name | 1,5-bis(4-ethoxy-2-pyridinyl)pentane-1,3,5-tricarbaldehyde |
|---|---|
| PubChem CID | 174481147 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1,5-bis(4-ethoxy-2-pyridinyl)pentane-1,3,5-tricarbaldehyde |
| SMILES | CCOc1ccnc(C(C=O)CC(C=O)CC(C=O)c2cc(OCC)ccn2)c1 |
| InChI | InChI=1S/C22H26N2O5/c1-3-28-19-5-7-23-21(11-19)17(14-26)9-16(13-25)10-18(15-27)22-12-20(29-4-2)6-8-24-22/h5-8,11-18H,3-4,9-10H2,1-2H3 |
| InChIKey | MTTJOAKCDJQDLO-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 95.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|