C15H20F2N2O2 — CID 161356801
(E)-1-[(4-ethoxy-2-pyridinyl)amino]-7,7-difluorooct-5-en-4-one (PubChem CID 161356801) has the molecular formula C15H20F2N2O2 and a molecular weight of 298.33 g/mol. Its IUPAC name is (E)-1-[(4-ethoxy-2-pyridinyl)amino]-7,7-difluorooct-5-en-4-one.
| Compound Name | (E)-1-[(4-ethoxy-2-pyridinyl)amino]-7,7-difluorooct-5-en-4-one |
|---|---|
| PubChem CID | 161356801 |
| Molecular Formula | C15H20F2N2O2 |
| Molecular Weight | 298.33 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (E)-1-[(4-ethoxy-2-pyridinyl)amino]-7,7-difluorooct-5-en-4-one |
| SMILES | CCOc1ccnc(NCCCC(=O)/C=C/C(C)(F)F)c1 |
| InChI | InChI=1S/C15H20F2N2O2/c1-3-21-13-7-10-19-14(11-13)18-9-4-5-12(20)6-8-15(2,16)17/h6-8,10-11H,3-5,9H2,1-2H3,(H,18,19)/b8-6+ |
| InChIKey | VOQPNAFZYKFUMB-SOFGYWHQSA-N |
| XLogP | 3.45 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.33 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|