C15H15F5N2O2 — CID 157249590
(E)-1-[(2-acetyl-4-pyridinyl)amino]-7,7,8,8,8-pentafluorooct-5-en-4-one (PubChem CID 157249590) has the molecular formula C15H15F5N2O2 and a molecular weight of 350.29 g/mol. Its IUPAC name is (E)-1-[(2-acetyl-4-pyridinyl)amino]-7,7,8,8,8-pentafluorooct-5-en-4-one.
| Compound Name | (E)-1-[(2-acetyl-4-pyridinyl)amino]-7,7,8,8,8-pentafluorooct-5-en-4-one |
|---|---|
| PubChem CID | 157249590 |
| Molecular Formula | C15H15F5N2O2 |
| Molecular Weight | 350.29 g/mol |
| Exact Mass | 350.11 |
| IUPAC Name | (E)-1-[(2-acetyl-4-pyridinyl)amino]-7,7,8,8,8-pentafluorooct-5-en-4-one |
| SMILES | CC(=O)c1cc(NCCCC(=O)/C=C/C(F)(F)C(F)(F)F)ccn1 |
| InChI | InChI=1S/C15H15F5N2O2/c1-10(23)13-9-11(5-8-22-13)21-7-2-3-12(24)4-6-14(16,17)15(18,19)20/h4-6,8-9H,2-3,7H2,1H3,(H,21,22)/b6-4+ |
| InChIKey | AWELBPPIAWYIPL-GQCTYLIASA-N |
| XLogP | 3.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.29 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|