C22H20FN3O2 — CID 174481444
N-(2-fluoro-4-nitrophenyl)-1-methyl-2,2-diphenylazetidin-3-amine (PubChem CID 174481444) has the molecular formula C22H20FN3O2 and a molecular weight of 377.42 g/mol. Its IUPAC name is N-(2-fluoro-4-nitrophenyl)-1-methyl-2,2-diphenylazetidin-3-amine.
| Compound Name | N-(2-fluoro-4-nitrophenyl)-1-methyl-2,2-diphenylazetidin-3-amine |
|---|---|
| PubChem CID | 174481444 |
| Molecular Formula | C22H20FN3O2 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.15 |
| IUPAC Name | N-(2-fluoro-4-nitrophenyl)-1-methyl-2,2-diphenylazetidin-3-amine |
| SMILES | CN1CC(Nc2ccc([N+](=O)[O-])cc2F)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H20FN3O2/c1-25-15-21(24-20-13-12-18(26(27)28)14-19(20)23)22(25,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,21,24H,15H2,1H3 |
| InChIKey | XPJSMWBEQBZPFM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|