C14H26O12 — CID 174482018
ethyl 2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate (PubChem CID 174482018) has the molecular formula C14H26O12 and a molecular weight of 386.35 g/mol. Its IUPAC name is ethyl 2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate.
| Compound Name | ethyl 2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate |
|---|---|
| PubChem CID | 174482018 |
| Molecular Formula | C14H26O12 |
| Molecular Weight | 386.35 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | ethyl 2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanoate |
| SMILES | CCOC(=O)C(O)C(O)C(O[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)C(O)CO |
| InChI | InChI=1S/C14H26O12/c1-2-24-13(23)10(21)9(20)12(5(17)3-15)26-14-11(22)8(19)7(18)6(4-16)25-14/h5-12,14-22H,2-4H2,1H3/t5?,6-,7-,8+,9?,10?,11-,12?,14-/m1/s1 |
| InChIKey | ZJJYSQYDTLEEON-PCJFZUEYSA-N |
| XLogP | -5.19 |
| TPSA | 206.60 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.35 |
| LogP ≤ 5 | -5.19 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |