C12H23NO11 — CID 139626132
(2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide (PubChem CID 139626132) has the molecular formula C12H23NO11 and a molecular weight of 357.31 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide.
| Compound Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
|---|---|
| PubChem CID | 139626132 |
| Molecular Formula | C12H23NO11 |
| Molecular Weight | 357.31 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | (2R,3R,4R,5R)-2,3,5,6-tetrahydroxy-4-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyhexanamide |
| SMILES | NC(=O)[C@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O)[C@H](O)CO |
| InChI | InChI=1S/C12H23NO11/c13-11(22)8(20)7(19)10(3(16)1-14)24-12-9(21)6(18)5(17)4(2-15)23-12/h3-10,12,14-21H,1-2H2,(H2,13,22)/t3-,4-,5+,6+,7-,8-,9-,10-,12-/m1/s1 |
| InChIKey | NQHGWZGJBPOWKN-DZFPMIMSSA-N |
| XLogP | -6.27 |
| TPSA | 223.39 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.31 |
| LogP ≤ 5 | -6.27 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |