C18H25NOS2 — CID 174482210
2-(aminomethyl)-4-[3-[5-(1-sulfanylethyl)thiophen-2-yl]pentyl]phenol (PubChem CID 174482210) has the molecular formula C18H25NOS2 and a molecular weight of 335.54 g/mol. Its IUPAC name is 2-(aminomethyl)-4-[3-[5-(1-sulfanylethyl)thiophen-2-yl]pentyl]phenol.
| Compound Name | 2-(aminomethyl)-4-[3-[5-(1-sulfanylethyl)thiophen-2-yl]pentyl]phenol |
|---|---|
| PubChem CID | 174482210 |
| Molecular Formula | C18H25NOS2 |
| Molecular Weight | 335.54 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-(aminomethyl)-4-[3-[5-(1-sulfanylethyl)thiophen-2-yl]pentyl]phenol |
| SMILES | CCC(CCc1ccc(O)c(CN)c1)c1ccc(C(C)S)s1 |
| InChI | InChI=1S/C18H25NOS2/c1-3-14(18-9-8-17(22-18)12(2)21)6-4-13-5-7-16(20)15(10-13)11-19/h5,7-10,12,14,20-21H,3-4,6,11,19H2,1-2H3 |
| InChIKey | RDOJCIKFUBJPJR-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.54 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|