C18H21NO4 — CID 174482402
bicyclo[4.1.0]hepta-1,3,5-trien-7-one;1,2-diethoxybenzene;N-methylidenehydroxylamine (PubChem CID 174482402) has the molecular formula C18H21NO4 and a molecular weight of 315.37 g/mol. Its IUPAC name is bicyclo[4.1.0]hepta-1,3,5-trien-7-one;1,2-diethoxybenzene;N-methylidenehydroxylamine.
| Compound Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;1,2-diethoxybenzene;N-methylidenehydroxylamine |
|---|---|
| PubChem CID | 174482402 |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.37 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | bicyclo[4.1.0]hepta-1,3,5-trien-7-one;1,2-diethoxybenzene;N-methylidenehydroxylamine |
| SMILES | C=NO.CCOc1ccccc1OCC.O=c1c2ccccc12 |
| InChI | InChI=1S/C10H14O2.C7H4O.CH3NO/c1-3-11-9-7-5-6-8-10(9)12-4-2;8-7-5-3-1-2-4-6(5)7;1-2-3/h5-8H,3-4H2,1-2H3;1-4H;3H,1H2 |
| InChIKey | LLZHJMUTJUGVQN-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|