About octan-3-yl N-(3-fluorophenyl)carbamate
octan-3-yl N-(3-fluorophenyl)carbamate (PubChem CID 174482782) has the molecular formula C15H22FNO2
and a molecular weight of 267.34 g/mol. Its IUPAC name is octan-3-yl N-(3-fluorophenyl)carbamate.
Molecular Properties
| Compound Name | octan-3-yl N-(3-fluorophenyl)carbamate |
| PubChem CID | 174482782 |
| Molecular Formula | C15H22FNO2 |
| Molecular Weight | 267.34 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | octan-3-yl N-(3-fluorophenyl)carbamate |
| SMILES | CCCCCC(CC)OC(=O)Nc1cccc(F)c1 |
| InChI | InChI=1S/C15H22FNO2/c1-3-5-6-10-14(4-2)19-15(18)17-13-9-7-8-12(16)11-13/h7-9,11,14H,3-6,10H2,1-2H3,(H,17,18) |
| InChIKey | ZGUOPBLVVWYLMH-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-3-yl N-(3-fluorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-3-yl N-(3-fluorophenyl)carbamate?
The IUPAC name of octan-3-yl N-(3-fluorophenyl)carbamate (CID 174482782) is octan-3-yl N-(3-fluorophenyl)carbamate.
What is the SMILES notation for octan-3-yl N-(3-fluorophenyl)carbamate?
The canonical SMILES for octan-3-yl N-(3-fluorophenyl)carbamate is CCCCCC(CC)OC(=O)Nc1cccc(F)c1.
What is the InChIKey of octan-3-yl N-(3-fluorophenyl)carbamate?
The InChIKey is ZGUOPBLVVWYLMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22FNO2/c1-3-5-6-10-14(4-2)19-15(18)17-13-9-7-8-12(16)11-13/h7-9,11,14H,3-6,10H2,1-2H3,(H,17,18).
What are the key properties of octan-3-yl N-(3-fluorophenyl)carbamate?
octan-3-yl N-(3-fluorophenyl)carbamate has a molecular weight of 267.34 g/mol, XLogP of 4.73, 7 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octan-3-yl N-(3-fluorophenyl)carbamate is sourced from PubChem (CID 174482782), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).