C32H32N2O2 — CID 174483217
acetonitrile;(2S)-2-[ethyl(trityl)amino]-3-phenylpropanoic acid (PubChem CID 174483217) has the molecular formula C32H32N2O2 and a molecular weight of 476.62 g/mol. Its IUPAC name is acetonitrile;(2S)-2-[ethyl(trityl)amino]-3-phenylpropanoic acid.
| Compound Name | acetonitrile;(2S)-2-[ethyl(trityl)amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 174483217 |
| Molecular Formula | C32H32N2O2 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.25 |
| IUPAC Name | acetonitrile;(2S)-2-[ethyl(trityl)amino]-3-phenylpropanoic acid |
| SMILES | CC#N.CCN([C@@H](Cc1ccccc1)C(=O)O)C(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29NO2.C2H3N/c1-2-31(28(29(32)33)23-24-15-7-3-8-16-24)30(25-17-9-4-10-18-25,26-19-11-5-12-20-26)27-21-13-6-14-22-27;1-2-3/h3-22,28H,2,23H2,1H3,(H,32,33);1H3/t28-;/m0./s1 |
| InChIKey | BJWXQPYBHATWJZ-JCOPYZAKSA-N |
| XLogP | 6.53 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|