C17H37N3O26P8 — CID 87259625
(2S)-2-[bis[[diphosphonomethyl(ethyl)amino]-diphosphonomethyl]amino]-3-phenylpropanoic acid (PubChem CID 87259625) has the molecular formula C17H37N3O26P8 and a molecular weight of 947.27 g/mol. Its IUPAC name is (2S)-2-[bis[[diphosphonomethyl(ethyl)amino]-diphosphonomethyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[bis[[diphosphonomethyl(ethyl)amino]-diphosphonomethyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87259625 |
| Molecular Formula | C17H37N3O26P8 |
| Molecular Weight | 947.27 g/mol |
| Exact Mass | 946.96 |
| IUPAC Name | (2S)-2-[bis[[diphosphonomethyl(ethyl)amino]-diphosphonomethyl]amino]-3-phenylpropanoic acid |
| SMILES | CCN(C(P(=O)(O)O)P(=O)(O)O)C(N([C@@H](Cc1ccccc1)C(=O)O)C(N(CC)C(P(=O)(O)O)P(=O)(O)O)(P(=O)(O)O)P(=O)(O)O)(P(=O)(O)O)P(=O)(O)O |
| InChI | InChI=1S/C17H37N3O26P8/c1-3-18(14(47(23,24)25)48(26,27)28)16(51(35,36)37,52(38,39)40)20(12(13(21)22)10-11-8-6-5-7-9-11)17(53(41,42)43,54(44,45)46)19(4-2)15(49(29,30)31)50(32,33)34/h5-9,12,14-15H,3-4,10H2,1-2H3,(H,21,22)(H2,23,24,25)(H2,26,27,28)(H2,29,30,31)(H2,32,33,34)(H2,35,36,37)(H2,38,39,40)(H2,41,42,43)(H2,44,45,46)/t12-/m0/s1 |
| InChIKey | IZWFQSYBBONKQA-LBPRGKRZSA-N |
| XLogP | -2.16 |
| TPSA | 507.26 Ų |
| H-Bond Donors | 17 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.27 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 17 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|