C10H12ClN3O3S — CID 174484167
N'-(3-chlorothiophene-2-carbonyl)morpholine-4-carbohydrazide (PubChem CID 174484167) has the molecular formula C10H12ClN3O3S and a molecular weight of 289.74 g/mol. Its IUPAC name is N'-(3-chlorothiophene-2-carbonyl)morpholine-4-carbohydrazide.
| Compound Name | N'-(3-chlorothiophene-2-carbonyl)morpholine-4-carbohydrazide |
|---|---|
| PubChem CID | 174484167 |
| Molecular Formula | C10H12ClN3O3S |
| Molecular Weight | 289.74 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N'-(3-chlorothiophene-2-carbonyl)morpholine-4-carbohydrazide |
| SMILES | O=C(NNC(=O)N1CCOCC1)c1sccc1Cl |
| InChI | InChI=1S/C10H12ClN3O3S/c11-7-1-6-18-8(7)9(15)12-13-10(16)14-2-4-17-5-3-14/h1,6H,2-5H2,(H,12,15)(H,13,16) |
| InChIKey | NXKUMXCABCNKGS-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.74 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|