C10H12ClN3O2S2 — CID 11587575
5-chloro-N'-(morpholine-4-carbothioyl)thiophene-2-carbohydrazide (PubChem CID 11587575) has the molecular formula C10H12ClN3O2S2 and a molecular weight of 305.81 g/mol. Its IUPAC name is 5-chloro-N'-(morpholine-4-carbothioyl)thiophene-2-carbohydrazide.
| Compound Name | 5-chloro-N'-(morpholine-4-carbothioyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 11587575 |
| Molecular Formula | C10H12ClN3O2S2 |
| Molecular Weight | 305.81 g/mol |
| Exact Mass | 305.01 |
| IUPAC Name | 5-chloro-N'-(morpholine-4-carbothioyl)thiophene-2-carbohydrazide |
| SMILES | O=C(NNC(=S)N1CCOCC1)c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H12ClN3O2S2/c11-8-2-1-7(18-8)9(15)12-13-10(17)14-3-5-16-6-4-14/h1-2H,3-6H2,(H,12,15)(H,13,17) |
| InChIKey | AFVIFLGWKDMMAC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.81 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|