About 3-chloro-2-methanidylprop-1-ene;ethanol;titanium
3-chloro-2-methanidylprop-1-ene;ethanol;titanium (PubChem CID 174484856) has the molecular formula C10H24ClO3Ti-
and a molecular weight of 275.62 g/mol. Its IUPAC name is 3-chloro-2-methanidylprop-1-ene;ethanol;titanium.
Molecular Properties
| Compound Name | 3-chloro-2-methanidylprop-1-ene;ethanol;titanium |
| PubChem CID | 174484856 |
| Molecular Formula | C10H24ClO3Ti- |
| Molecular Weight | 275.62 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | 3-chloro-2-methanidylprop-1-ene;ethanol;titanium |
| SMILES | C=C([CH2-])CCl.CCO.CCO.CCO.[Ti] |
| InChI | InChI=1S/C4H6Cl.3C2H6O.Ti/c1-4(2)3-5;3*1-2-3;/h1-3H2;3*3H,2H2,1H3;/q-1;;;; |
| InChIKey | YELFTYHZOBAFAH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.62 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-2-methanidylprop-1-ene;ethanol;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-2-methanidylprop-1-ene;ethanol;titanium?
The IUPAC name of 3-chloro-2-methanidylprop-1-ene;ethanol;titanium (CID 174484856) is 3-chloro-2-methanidylprop-1-ene;ethanol;titanium.
What is the SMILES notation for 3-chloro-2-methanidylprop-1-ene;ethanol;titanium?
The canonical SMILES for 3-chloro-2-methanidylprop-1-ene;ethanol;titanium is C=C([CH2-])CCl.CCO.CCO.CCO.[Ti].
What is the InChIKey of 3-chloro-2-methanidylprop-1-ene;ethanol;titanium?
The InChIKey is YELFTYHZOBAFAH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl.3C2H6O.Ti/c1-4(2)3-5;3*1-2-3;/h1-3H2;3*3H,2H2,1H3;/q-1;;;;.
What are the key properties of 3-chloro-2-methanidylprop-1-ene;ethanol;titanium?
3-chloro-2-methanidylprop-1-ene;ethanol;titanium has a molecular weight of 275.62 g/mol, XLogP of 1.61, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-2-methanidylprop-1-ene;ethanol;titanium is sourced from PubChem (CID 174484856), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).