C18H26Cl2O3 — CID 174488314
2-chloro-12-(4-chlorophenyl)-10-hydroxydodecanoic acid (PubChem CID 174488314) has the molecular formula C18H26Cl2O3 and a molecular weight of 361.31 g/mol. Its IUPAC name is 2-chloro-12-(4-chlorophenyl)-10-hydroxydodecanoic acid.
| Compound Name | 2-chloro-12-(4-chlorophenyl)-10-hydroxydodecanoic acid |
|---|---|
| PubChem CID | 174488314 |
| Molecular Formula | C18H26Cl2O3 |
| Molecular Weight | 361.31 g/mol |
| Exact Mass | 360.13 |
| IUPAC Name | 2-chloro-12-(4-chlorophenyl)-10-hydroxydodecanoic acid |
| SMILES | O=C(O)C(Cl)CCCCCCCC(O)CCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H26Cl2O3/c19-15-11-8-14(9-12-15)10-13-16(21)6-4-2-1-3-5-7-17(20)18(22)23/h8-9,11-12,16-17,21H,1-7,10,13H2,(H,22,23) |
| InChIKey | RUOXHQDODUVUKH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.31 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|