C18H25Cl3O3 — CID 11200291
2,2-dichloro-12-(4-chlorophenyl)-11-hydroxydodecanoic acid (PubChem CID 11200291) has the molecular formula C18H25Cl3O3 and a molecular weight of 395.75 g/mol. Its IUPAC name is 2,2-dichloro-12-(4-chlorophenyl)-11-hydroxydodecanoic acid.
| Compound Name | 2,2-dichloro-12-(4-chlorophenyl)-11-hydroxydodecanoic acid |
|---|---|
| PubChem CID | 11200291 |
| Molecular Formula | C18H25Cl3O3 |
| Molecular Weight | 395.75 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 2,2-dichloro-12-(4-chlorophenyl)-11-hydroxydodecanoic acid |
| SMILES | O=C(O)C(Cl)(Cl)CCCCCCCCC(O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H25Cl3O3/c19-15-10-8-14(9-11-15)13-16(22)7-5-3-1-2-4-6-12-18(20,21)17(23)24/h8-11,16,22H,1-7,12-13H2,(H,23,24) |
| InChIKey | CIKFPNRPYBXWEC-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.75 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|