C19H27Cl3O — CID 89217400
3,3-dichloro-13-(4-chlorophenyl)tridec-1-en-2-ol (PubChem CID 89217400) has the molecular formula C19H27Cl3O and a molecular weight of 377.78 g/mol. Its IUPAC name is 3,3-dichloro-13-(4-chlorophenyl)tridec-1-en-2-ol.
| Compound Name | 3,3-dichloro-13-(4-chlorophenyl)tridec-1-en-2-ol |
|---|---|
| PubChem CID | 89217400 |
| Molecular Formula | C19H27Cl3O |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 3,3-dichloro-13-(4-chlorophenyl)tridec-1-en-2-ol |
| SMILES | C=C(O)C(Cl)(Cl)CCCCCCCCCCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H27Cl3O/c1-16(23)19(21,22)15-9-7-5-3-2-4-6-8-10-17-11-13-18(20)14-12-17/h11-14,23H,1-10,15H2 |
| InChIKey | PXEMJNUZKHNDHM-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|