C6H11NO — CID 174489526
2-ethenyl-5-methyl-1,3-oxazolidine (PubChem CID 174489526) has the molecular formula C6H11NO and a molecular weight of 113.16 g/mol. Its IUPAC name is 2-ethenyl-5-methyl-1,3-oxazolidine.
| Compound Name | 2-ethenyl-5-methyl-1,3-oxazolidine |
|---|---|
| PubChem CID | 174489526 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | 2-ethenyl-5-methyl-1,3-oxazolidine |
| SMILES | C=CC1NCC(C)O1 |
| InChI | InChI=1S/C6H11NO/c1-3-6-7-4-5(2)8-6/h3,5-7H,1,4H2,2H3 |
| InChIKey | KKPCZCOXBQBWCV-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|