C8H15NO — CID 10678340
(4R)-4-ethyl-2-[(E)-prop-1-enyl]-1,3-oxazolidine (PubChem CID 10678340) has the molecular formula C8H15NO and a molecular weight of 141.21 g/mol. Its IUPAC name is (4R)-4-ethyl-2-[(E)-prop-1-enyl]-1,3-oxazolidine.
| Compound Name | (4R)-4-ethyl-2-[(E)-prop-1-enyl]-1,3-oxazolidine |
|---|---|
| PubChem CID | 10678340 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | (4R)-4-ethyl-2-[(E)-prop-1-enyl]-1,3-oxazolidine |
| SMILES | C/C=C/C1N[C@H](CC)CO1 |
| InChI | InChI=1S/C8H15NO/c1-3-5-8-9-7(4-2)6-10-8/h3,5,7-9H,4,6H2,1-2H3/b5-3+/t7-,8?/m1/s1 |
| InChIKey | GBDFTLFBCUYPAY-UPIOBMIPSA-N |
| XLogP | 1.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|