C9H21MgN — CID 174489756
magnesium;2-cyclopropyl-N,N-diethylethanamine;hydride (PubChem CID 174489756) has the molecular formula C9H21MgN and a molecular weight of 167.58 g/mol. Its IUPAC name is magnesium;2-cyclopropyl-N,N-diethylethanamine;hydride.
| Compound Name | magnesium;2-cyclopropyl-N,N-diethylethanamine;hydride |
|---|---|
| PubChem CID | 174489756 |
| Molecular Formula | C9H21MgN |
| Molecular Weight | 167.58 g/mol |
| Exact Mass | 167.15 |
| IUPAC Name | magnesium;2-cyclopropyl-N,N-diethylethanamine;hydride |
| SMILES | CCN(CC)CCC1CC1.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C9H19N.Mg.2H/c1-3-10(4-2)8-7-9-5-6-9;;;/h9H,3-8H2,1-2H3;;;/q;+2;2*-1 |
| InChIKey | ZPAYESZTKFBLDL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.58 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |