C20H14ClF3N6O — CID 174490474
1-[3-[8-(4-chloroanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]-3-(trifluoromethyl)urea (PubChem CID 174490474) has the molecular formula C20H14ClF3N6O and a molecular weight of 446.82 g/mol. Its IUPAC name is 1-[3-[8-(4-chloroanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]-3-(trifluoromethyl)urea.
| Compound Name | 1-[3-[8-(4-chloroanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]-3-(trifluoromethyl)urea |
|---|---|
| PubChem CID | 174490474 |
| Molecular Formula | C20H14ClF3N6O |
| Molecular Weight | 446.82 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 1-[3-[8-(4-chloroanilino)imidazo[1,2-a]pyrazin-6-yl]phenyl]-3-(trifluoromethyl)urea |
| SMILES | O=C(Nc1cccc(-c2cn3ccnc3c(Nc3ccc(Cl)cc3)n2)c1)NC(F)(F)F |
| InChI | InChI=1S/C20H14ClF3N6O/c21-13-4-6-14(7-5-13)26-17-18-25-8-9-30(18)11-16(28-17)12-2-1-3-15(10-12)27-19(31)29-20(22,23)24/h1-11H,(H,26,28)(H2,27,29,31) |
| InChIKey | FYNRBFLFJSQTQJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 83.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.82 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|