C27H20ClN3O4 — CID 174490981
10-(2-chlorophenyl)-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 174490981) has the molecular formula C27H20ClN3O4 and a molecular weight of 485.93 g/mol. Its IUPAC name is 10-(2-chlorophenyl)-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 10-(2-chlorophenyl)-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 174490981 |
| Molecular Formula | C27H20ClN3O4 |
| Molecular Weight | 485.93 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | 10-(2-chlorophenyl)-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | [H]/N=C/c1ccc2nc3c(c(-c4ccccc4Cl)c2c1)Cn1c-3cc2c(c1=O)COC(=O)C2(O)CC |
| InChI | InChI=1S/C27H20ClN3O4/c1-2-27(34)19-10-22-24-17(12-31(22)25(32)18(19)13-35-26(27)33)23(15-5-3-4-6-20(15)28)16-9-14(11-29)7-8-21(16)30-24/h3-11,29,34H,2,12-13H2,1H3/b29-11+ |
| InChIKey | QJIROTYFLMUFRX-VPUKRXIYSA-N |
| XLogP | 4.40 |
| TPSA | 105.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.93 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|