C25H26N4O4 — CID 174371629
10-[2-(dimethylamino)ethyl]-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione (PubChem CID 174371629) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is 10-[2-(dimethylamino)ethyl]-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione.
| Compound Name | 10-[2-(dimethylamino)ethyl]-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
|---|---|
| PubChem CID | 174371629 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | 10-[2-(dimethylamino)ethyl]-19-ethyl-19-hydroxy-7-methanimidoyl-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaene-14,18-dione |
| SMILES | [H]/N=C/c1ccc2nc3c(c(CCN(C)C)c2c1)Cn1c-3cc2c(c1=O)COC(=O)C2(O)CC |
| InChI | InChI=1S/C25H26N4O4/c1-4-25(32)19-10-21-22-17(12-29(21)23(30)18(19)13-33-24(25)31)15(7-8-28(2)3)16-9-14(11-26)5-6-20(16)27-22/h5-6,9-11,26,32H,4,7-8,12-13H2,1-3H3/b26-11+ |
| InChIKey | CSFGSRSODNSUNX-KBKYJPHKSA-N |
| XLogP | 2.18 |
| TPSA | 108.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|