C28H33N3O5SSi — CID 25266353
O-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-10-(2-trimethylsilylethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl]] N,N-dimethylcarbamothioate (PubChem CID 25266353) has the molecular formula C28H33N3O5SSi and a molecular weight of 551.74 g/mol. Its IUPAC name is O-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-10-(2-trimethylsilylethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl]] N,N-dimethylcarbamothioate.
| Compound Name | O-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-10-(2-trimethylsilylethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl]] N,N-dimethylcarbamothioate |
|---|---|
| PubChem CID | 25266353 |
| Molecular Formula | C28H33N3O5SSi |
| Molecular Weight | 551.74 g/mol |
| Exact Mass | 551.19 |
| IUPAC Name | O-[[(19S)-19-ethyl-19-hydroxy-14,18-dioxo-10-(2-trimethylsilylethyl)-17-oxa-3,13-diazapentacyclo[11.8.0.02,11.04,9.015,20]henicosa-1(21),2,4(9),5,7,10,15(20)-heptaen-7-yl]] N,N-dimethylcarbamothioate |
| SMILES | CC[C@@]1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1ccc(OC(=S)N(C)C)cc1c2CC[Si](C)(C)C |
| InChI | InChI=1S/C28H33N3O5SSi/c1-7-28(34)21-13-23-24-19(14-31(23)25(32)20(21)15-35-26(28)33)17(10-11-38(4,5)6)18-12-16(8-9-22(18)29-24)36-27(37)30(2)3/h8-9,12-13,34H,7,10-11,14-15H2,1-6H3/t28-/m0/s1 |
| InChIKey | KHVLJFWTQJOJMN-NDEPHWFRSA-N |
| XLogP | 4.19 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.74 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|