C28H38N2O6 — CID 174494135
1-O-amino 3-O-tert-butyl (2S)-2-[3-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-phenylphenyl]propyl]propanedioate (PubChem CID 174494135) has the molecular formula C28H38N2O6 and a molecular weight of 498.62 g/mol. Its IUPAC name is 1-O-amino 3-O-tert-butyl (2S)-2-[3-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-phenylphenyl]propyl]propanedioate.
| Compound Name | 1-O-amino 3-O-tert-butyl (2S)-2-[3-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-phenylphenyl]propyl]propanedioate |
|---|---|
| PubChem CID | 174494135 |
| Molecular Formula | C28H38N2O6 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.27 |
| IUPAC Name | 1-O-amino 3-O-tert-butyl (2S)-2-[3-[2-[[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]-4-phenylphenyl]propyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)CNc1cc(-c2ccccc2)ccc1CCC[C@H](C(=O)ON)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C28H38N2O6/c1-27(2,3)34-24(31)18-30-23-17-21(19-11-8-7-9-12-19)16-15-20(23)13-10-14-22(26(33)36-29)25(32)35-28(4,5)6/h7-9,11-12,15-17,22,30H,10,13-14,18,29H2,1-6H3/t22-/m0/s1 |
| InChIKey | ALQAIVQACPFIKR-QFIPXVFZSA-N |
| XLogP | 4.80 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|