About 2-methylpropanoyl 3-aminobutanoate
2-methylpropanoyl 3-aminobutanoate (PubChem CID 174497316) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is 2-methylpropanoyl 3-aminobutanoate.
Molecular Properties
| Compound Name | 2-methylpropanoyl 3-aminobutanoate |
| PubChem CID | 174497316 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | 2-methylpropanoyl 3-aminobutanoate |
| SMILES | CC(N)CC(=O)OC(=O)C(C)C |
| InChI | InChI=1S/C8H15NO3/c1-5(2)8(11)12-7(10)4-6(3)9/h5-6H,4,9H2,1-3H3 |
| InChIKey | BXLCMEPOQSDIBF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanoyl 3-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanoyl 3-aminobutanoate?
The IUPAC name of 2-methylpropanoyl 3-aminobutanoate (CID 174497316) is 2-methylpropanoyl 3-aminobutanoate.
What is the SMILES notation for 2-methylpropanoyl 3-aminobutanoate?
The canonical SMILES for 2-methylpropanoyl 3-aminobutanoate is CC(N)CC(=O)OC(=O)C(C)C.
What is the InChIKey of 2-methylpropanoyl 3-aminobutanoate?
The InChIKey is BXLCMEPOQSDIBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-5(2)8(11)12-7(10)4-6(3)9/h5-6H,4,9H2,1-3H3.
What are the key properties of 2-methylpropanoyl 3-aminobutanoate?
2-methylpropanoyl 3-aminobutanoate has a molecular weight of 173.21 g/mol, XLogP of 0.45, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanoyl 3-aminobutanoate is sourced from PubChem (CID 174497316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).