C27H24F3IN2O4S — CID 174498106
N-[[4-(3-cyclopropylprop-2-enylsulfonyl)phenyl]methyl]-5-iodo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide (PubChem CID 174498106) has the molecular formula C27H24F3IN2O4S and a molecular weight of 656.46 g/mol. Its IUPAC name is N-[[4-(3-cyclopropylprop-2-enylsulfonyl)phenyl]methyl]-5-iodo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide.
| Compound Name | N-[[4-(3-cyclopropylprop-2-enylsulfonyl)phenyl]methyl]-5-iodo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 174498106 |
| Molecular Formula | C27H24F3IN2O4S |
| Molecular Weight | 656.46 g/mol |
| Exact Mass | 656.05 |
| IUPAC Name | N-[[4-(3-cyclopropylprop-2-enylsulfonyl)phenyl]methyl]-5-iodo-6-methyl-2-oxo-1-[3-(trifluoromethyl)phenyl]pyridine-3-carboxamide |
| SMILES | Cc1c(I)cc(C(=O)NCc2ccc(S(=O)(=O)CC=CC3CC3)cc2)c(=O)n1-c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H24F3IN2O4S/c1-17-24(31)15-23(26(35)33(17)21-6-2-5-20(14-21)27(28,29)30)25(34)32-16-19-9-11-22(12-10-19)38(36,37)13-3-4-18-7-8-18/h2-6,9-12,14-15,18H,7-8,13,16H2,1H3,(H,32,34) |
| InChIKey | BQENPFKBFPHENW-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 85.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.46 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|