C29H26F4O2 — CID 174500610
(1S)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6,7-dimethoxy-1,2,3,4-tetrahydrochrysene (PubChem CID 174500610) has the molecular formula C29H26F4O2 and a molecular weight of 482.52 g/mol. Its IUPAC name is (1S)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6,7-dimethoxy-1,2,3,4-tetrahydrochrysene.
| Compound Name | (1S)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6,7-dimethoxy-1,2,3,4-tetrahydrochrysene |
|---|---|
| PubChem CID | 174500610 |
| Molecular Formula | C29H26F4O2 |
| Molecular Weight | 482.52 g/mol |
| Exact Mass | 482.19 |
| IUPAC Name | (1S)-1-[2-[4-fluoro-3-(trifluoromethyl)phenyl]ethyl]-6,7-dimethoxy-1,2,3,4-tetrahydrochrysene |
| SMILES | COc1cccc2c1c(OC)cc1c3c(ccc12)[C@H](CCc1ccc(F)c(C(F)(F)F)c1)CCC3 |
| InChI | InChI=1S/C29H26F4O2/c1-34-26-8-4-7-22-21-13-12-19-18(5-3-6-20(19)23(21)16-27(35-2)28(22)26)11-9-17-10-14-25(30)24(15-17)29(31,32)33/h4,7-8,10,12-16,18H,3,5-6,9,11H2,1-2H3/t18-/m0/s1 |
| InChIKey | AJIMJXVCBBZQTF-SFHVURJKSA-N |
| XLogP | 8.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.52 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|