C25H28N4O5 — CID 174502452
(2R)-5-[3-[(1-benzyl-4-ethyl-5-oxo-1,2,4-triazol-3-yl)methoxy]phenyl]-2-ethyl-3-imino-4-oxopentanoic acid (PubChem CID 174502452) has the molecular formula C25H28N4O5 and a molecular weight of 464.52 g/mol. Its IUPAC name is (2R)-5-[3-[(1-benzyl-4-ethyl-5-oxo-1,2,4-triazol-3-yl)methoxy]phenyl]-2-ethyl-3-imino-4-oxopentanoic acid.
| Compound Name | (2R)-5-[3-[(1-benzyl-4-ethyl-5-oxo-1,2,4-triazol-3-yl)methoxy]phenyl]-2-ethyl-3-imino-4-oxopentanoic acid |
|---|---|
| PubChem CID | 174502452 |
| Molecular Formula | C25H28N4O5 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | (2R)-5-[3-[(1-benzyl-4-ethyl-5-oxo-1,2,4-triazol-3-yl)methoxy]phenyl]-2-ethyl-3-imino-4-oxopentanoic acid |
| SMILES | [H]/N=C(/C(=O)Cc1cccc(OCc2nn(Cc3ccccc3)c(=O)n2CC)c1)[C@@H](CC)C(=O)O |
| InChI | InChI=1S/C25H28N4O5/c1-3-20(24(31)32)23(26)21(30)14-18-11-8-12-19(13-18)34-16-22-27-29(25(33)28(22)4-2)15-17-9-6-5-7-10-17/h5-13,20,26H,3-4,14-16H2,1-2H3,(H,31,32)/b26-23+/t20-/m1/s1 |
| InChIKey | WCXXHPLESZTESN-UAPGPWSHSA-N |
| XLogP | 2.93 |
| TPSA | 127.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|