C46H82O2 — CID 174502863
[6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylheptyl] (Z)-octadec-9-enoate (PubChem CID 174502863) has the molecular formula C46H82O2 and a molecular weight of 667.16 g/mol. Its IUPAC name is [6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylheptyl] (Z)-octadec-9-enoate.
| Compound Name | [6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylheptyl] (Z)-octadec-9-enoate |
|---|---|
| PubChem CID | 174502863 |
| Molecular Formula | C46H82O2 |
| Molecular Weight | 667.16 g/mol |
| Exact Mass | 666.63 |
| IUPAC Name | [6-[(8R,9S,10S,13R,14S,17R)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2,3-dimethylheptyl] (Z)-octadec-9-enoate |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)OCC(C)C(C)CCC(C)[C@H]1CC[C@H]2[C@@H]3CCC4CCCC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C46H82O2/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-44(47)48-35-38(4)36(2)26-27-37(3)41-30-31-42-40-29-28-39-24-22-23-33-45(39,5)43(40)32-34-46(41,42)6/h14-15,36-43H,7-13,16-35H2,1-6H3/b15-14-/t36?,37?,38?,39?,40-,41+,42-,43-,45-,46+/m0/s1 |
| InChIKey | NQKOPLQHLZXZDG-KKDFVCKWSA-N |
| XLogP | 14.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.16 |
| LogP ≤ 5 | 14.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|