About azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate
azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate (PubChem CID 174502970) has the molecular formula C10H26N2O4S
and a molecular weight of 270.39 g/mol. Its IUPAC name is azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate.
Molecular Properties
| Compound Name | azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate |
| PubChem CID | 174502970 |
| Molecular Formula | C10H26N2O4S |
| Molecular Weight | 270.39 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate |
| SMILES | CCCCCNCC(C)(C)OS(=O)(=O)OC.N |
| InChI | InChI=1S/C10H23NO4S.H3N/c1-5-6-7-8-11-9-10(2,3)15-16(12,13)14-4;/h11H,5-9H2,1-4H3;1H3 |
| InChIKey | ZYMJLUGACPYLMD-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 99.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate?
The IUPAC name of azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate (CID 174502970) is azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate.
What is the SMILES notation for azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate?
The canonical SMILES for azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate is CCCCCNCC(C)(C)OS(=O)(=O)OC.N.
What is the InChIKey of azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate?
The InChIKey is ZYMJLUGACPYLMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23NO4S.H3N/c1-5-6-7-8-11-9-10(2,3)15-16(12,13)14-4;/h11H,5-9H2,1-4H3;1H3.
What are the key properties of azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate?
azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate has a molecular weight of 270.39 g/mol, XLogP of 1.61, 9 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl [2-methyl-1-(pentylamino)propan-2-yl] sulfate is sourced from PubChem (CID 174502970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).