About 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde
2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde (PubChem CID 174503413) has the molecular formula C24H18FNO5
and a molecular weight of 419.41 g/mol. Its IUPAC name is 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde.
Molecular Properties
| Compound Name | 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde |
| PubChem CID | 174503413 |
| Molecular Formula | C24H18FNO5 |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.12 |
| IUPAC Name | 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde |
| SMILES | Cc1cc(C(=O)O)c(F)c(C(=O)O)c1.O=Cc1cn(-c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C15H11NO.C9H7FO4/c17-11-12-10-16(13-6-2-1-3-7-13)15-9-5-4-8-14(12)15;1-4-2-5(8(11)12)7(10)6(3-4)9(13)14/h1-11H;2-3H,1H3,(H,11,12)(H,13,14) |
| InChIKey | FYHBRGSKNXIFMA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 96.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde?
The IUPAC name of 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde (CID 174503413) is 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde.
What is the SMILES notation for 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde?
The canonical SMILES for 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde is Cc1cc(C(=O)O)c(F)c(C(=O)O)c1.O=Cc1cn(-c2ccccc2)c2ccccc12.
What is the InChIKey of 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde?
The InChIKey is FYHBRGSKNXIFMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11NO.C9H7FO4/c17-11-12-10-16(13-6-2-1-3-7-13)15-9-5-4-8-14(12)15;1-4-2-5(8(11)12)7(10)6(3-4)9(13)14/h1-11H;2-3H,1H3,(H,11,12)(H,13,14).
What are the key properties of 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde?
2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde has a molecular weight of 419.41 g/mol, XLogP of 4.97, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;1-phenylindole-3-carbaldehyde is sourced from PubChem (CID 174503413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).