C16H14FNO5 — CID 174576861
benzene;2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;isocyanic acid (PubChem CID 174576861) has the molecular formula C16H14FNO5 and a molecular weight of 319.29 g/mol. Its IUPAC name is benzene;2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;isocyanic acid.
| Compound Name | benzene;2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;isocyanic acid |
|---|---|
| PubChem CID | 174576861 |
| Molecular Formula | C16H14FNO5 |
| Molecular Weight | 319.29 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | benzene;2-fluoro-5-methylbenzene-1,3-dicarboxylic acid;isocyanic acid |
| SMILES | Cc1cc(C(=O)O)c(F)c(C(=O)O)c1.N=C=O.c1ccccc1 |
| InChI | InChI=1S/C9H7FO4.C6H6.CHNO/c1-4-2-5(8(11)12)7(10)6(3-4)9(13)14;1-2-4-6-5-3-1;2-1-3/h2-3H,1H3,(H,11,12)(H,13,14);1-6H;2H |
| InChIKey | PKLSJZMMTDGJDL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 115.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.29 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|