C13H8F5NO2 — CID 115564074
2,5-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-3-carboxylic acid (PubChem CID 115564074) has the molecular formula C13H8F5NO2 and a molecular weight of 305.20 g/mol. Its IUPAC name is 2,5-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-3-carboxylic acid.
| Compound Name | 2,5-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 115564074 |
| Molecular Formula | C13H8F5NO2 |
| Molecular Weight | 305.20 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | 2,5-dimethyl-1-(2,3,4,5,6-pentafluorophenyl)pyrrole-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c(C)n1-c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C13H8F5NO2/c1-4-3-6(13(20)21)5(2)19(4)12-10(17)8(15)7(14)9(16)11(12)18/h3H,1-2H3,(H,20,21) |
| InChIKey | HFLMMHDVFYGBCA-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.20 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|