C12H14ClN3 — CID 174503477
azane;5-(2-chlorophenyl)-3,4-dimethylpyridazine (PubChem CID 174503477) has the molecular formula C12H14ClN3 and a molecular weight of 235.72 g/mol. Its IUPAC name is azane;5-(2-chlorophenyl)-3,4-dimethylpyridazine.
| Compound Name | azane;5-(2-chlorophenyl)-3,4-dimethylpyridazine |
|---|---|
| PubChem CID | 174503477 |
| Molecular Formula | C12H14ClN3 |
| Molecular Weight | 235.72 g/mol |
| Exact Mass | 235.09 |
| IUPAC Name | azane;5-(2-chlorophenyl)-3,4-dimethylpyridazine |
| SMILES | Cc1nncc(-c2ccccc2Cl)c1C.N |
| InChI | InChI=1S/C12H11ClN2.H3N/c1-8-9(2)15-14-7-11(8)10-5-3-4-6-12(10)13;/h3-7H,1-2H3;1H3 |
| InChIKey | NQYDYFMNGSCWCD-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 60.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.72 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |