C14H9Cl2FN4 — CID 174661750
3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;hydrofluoride (PubChem CID 174661750) has the molecular formula C14H9Cl2FN4 and a molecular weight of 323.16 g/mol. Its IUPAC name is 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;hydrofluoride.
| Compound Name | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;hydrofluoride |
|---|---|
| PubChem CID | 174661750 |
| Molecular Formula | C14H9Cl2FN4 |
| Molecular Weight | 323.16 g/mol |
| Exact Mass | 322.02 |
| IUPAC Name | 3,6-bis(2-chlorophenyl)-1,2,4,5-tetrazine;hydrofluoride |
| SMILES | Clc1ccccc1-c1nnc(-c2ccccc2Cl)nn1.F |
| InChI | InChI=1S/C14H8Cl2N4.FH/c15-11-7-3-1-5-9(11)13-17-19-14(20-18-13)10-6-2-4-8-12(10)16;/h1-8H;1H |
| InChIKey | YLWFULYRIHLXKB-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.16 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |