C10H9ClN4 — CID 83868891
2-(2-chlorophenyl)pyrimidine-4,6-diamine (PubChem CID 83868891) has the molecular formula C10H9ClN4 and a molecular weight of 220.66 g/mol. Its IUPAC name is 2-(2-chlorophenyl)pyrimidine-4,6-diamine.
| Compound Name | 2-(2-chlorophenyl)pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 83868891 |
| Molecular Formula | C10H9ClN4 |
| Molecular Weight | 220.66 g/mol |
| Exact Mass | 220.05 |
| IUPAC Name | 2-(2-chlorophenyl)pyrimidine-4,6-diamine |
| SMILES | Nc1cc(N)nc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C10H9ClN4/c11-7-4-2-1-3-6(7)10-14-8(12)5-9(13)15-10/h1-5H,(H4,12,13,14,15) |
| InChIKey | ICCGMXUHINJVLZ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.66 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |