C28H31N5S — CID 174504043
1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-naphthalen-1-ylthiourea (PubChem CID 174504043) has the molecular formula C28H31N5S and a molecular weight of 469.66 g/mol. Its IUPAC name is 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-naphthalen-1-ylthiourea.
| Compound Name | 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-naphthalen-1-ylthiourea |
|---|---|
| PubChem CID | 174504043 |
| Molecular Formula | C28H31N5S |
| Molecular Weight | 469.66 g/mol |
| Exact Mass | 469.23 |
| IUPAC Name | 1-[4-[[4-(dimethylamino)quinolin-2-yl]amino]cyclohexyl]-1-naphthalen-1-ylthiourea |
| SMILES | CN(C)c1cc(NC2CCC(N(C(N)=S)c3cccc4ccccc34)CC2)nc2ccccc12 |
| InChI | InChI=1S/C28H31N5S/c1-32(2)26-18-27(31-24-12-6-5-11-23(24)26)30-20-14-16-21(17-15-20)33(28(29)34)25-13-7-9-19-8-3-4-10-22(19)25/h3-13,18,20-21H,14-17H2,1-2H3,(H2,29,34)(H,30,31) |
| InChIKey | NKMIZTGEPBATAY-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 57.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.66 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|