About butyl-dimethyl-(prop-2-enoylamino)azanium;toluene
butyl-dimethyl-(prop-2-enoylamino)azanium;toluene (PubChem CID 174504549) has the molecular formula C16H27N2O+
and a molecular weight of 263.40 g/mol. Its IUPAC name is butyl-dimethyl-(prop-2-enoylamino)azanium;toluene.
Molecular Properties
| Compound Name | butyl-dimethyl-(prop-2-enoylamino)azanium;toluene |
| PubChem CID | 174504549 |
| Molecular Formula | C16H27N2O+ |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | butyl-dimethyl-(prop-2-enoylamino)azanium;toluene |
| SMILES | C=CC(=O)N[N+](C)(C)CCCC.Cc1ccccc1 |
| InChI | InChI=1S/C9H18N2O.C7H8/c1-5-7-8-11(3,4)10-9(12)6-2;1-7-5-3-2-4-6-7/h6H,2,5,7-8H2,1,3-4H3;2-6H,1H3/p+1 |
| InChIKey | NBMWENKXNXJWDH-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze butyl-dimethyl-(prop-2-enoylamino)azanium;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-dimethyl-(prop-2-enoylamino)azanium;toluene?
The IUPAC name of butyl-dimethyl-(prop-2-enoylamino)azanium;toluene (CID 174504549) is butyl-dimethyl-(prop-2-enoylamino)azanium;toluene.
What is the SMILES notation for butyl-dimethyl-(prop-2-enoylamino)azanium;toluene?
The canonical SMILES for butyl-dimethyl-(prop-2-enoylamino)azanium;toluene is C=CC(=O)N[N+](C)(C)CCCC.Cc1ccccc1.
What is the InChIKey of butyl-dimethyl-(prop-2-enoylamino)azanium;toluene?
The InChIKey is NBMWENKXNXJWDH-UHFFFAOYSA-O. The full InChI is InChI=1S/C9H18N2O.C7H8/c1-5-7-8-11(3,4)10-9(12)6-2;1-7-5-3-2-4-6-7/h6H,2,5,7-8H2,1,3-4H3;2-6H,1H3/p+1.
What are the key properties of butyl-dimethyl-(prop-2-enoylamino)azanium;toluene?
butyl-dimethyl-(prop-2-enoylamino)azanium;toluene has a molecular weight of 263.40 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-dimethyl-(prop-2-enoylamino)azanium;toluene is sourced from PubChem (CID 174504549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).