About 1H-imidazole;quinolin-6-amine
1H-imidazole;quinolin-6-amine (PubChem CID 174504983) has the molecular formula C12H12N4
and a molecular weight of 212.26 g/mol. Its IUPAC name is 1H-imidazole;quinolin-6-amine.
Molecular Properties
| Compound Name | 1H-imidazole;quinolin-6-amine |
| PubChem CID | 174504983 |
| Molecular Formula | C12H12N4 |
| Molecular Weight | 212.26 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | 1H-imidazole;quinolin-6-amine |
| SMILES | Nc1ccc2ncccc2c1.c1c[nH]cn1 |
| InChI | InChI=1S/C9H8N2.C3H4N2/c10-8-3-4-9-7(6-8)2-1-5-11-9;1-2-5-3-4-1/h1-6H,10H2;1-3H,(H,4,5) |
| InChIKey | OFAGNIRTOUKENC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1H-imidazole;quinolin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-imidazole;quinolin-6-amine?
The IUPAC name of 1H-imidazole;quinolin-6-amine (CID 174504983) is 1H-imidazole;quinolin-6-amine.
What is the SMILES notation for 1H-imidazole;quinolin-6-amine?
The canonical SMILES for 1H-imidazole;quinolin-6-amine is Nc1ccc2ncccc2c1.c1c[nH]cn1.
What is the InChIKey of 1H-imidazole;quinolin-6-amine?
The InChIKey is OFAGNIRTOUKENC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2.C3H4N2/c10-8-3-4-9-7(6-8)2-1-5-11-9;1-2-5-3-4-1/h1-6H,10H2;1-3H,(H,4,5).
What are the key properties of 1H-imidazole;quinolin-6-amine?
1H-imidazole;quinolin-6-amine has a molecular weight of 212.26 g/mol, XLogP of 2.23, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-imidazole;quinolin-6-amine is sourced from PubChem (CID 174504983), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).