About boric acid;bis(1H-imidazole);quinoline
boric acid;bis(1H-imidazole);quinoline (PubChem CID 174795094) has the molecular formula C15H18BN5O3
and a molecular weight of 327.15 g/mol. Its IUPAC name is boric acid;bis(1H-imidazole);quinoline.
Molecular Properties
| Compound Name | boric acid;bis(1H-imidazole);quinoline |
| PubChem CID | 174795094 |
| Molecular Formula | C15H18BN5O3 |
| Molecular Weight | 327.15 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | boric acid;bis(1H-imidazole);quinoline |
| SMILES | OB(O)O.c1c[nH]cn1.c1c[nH]cn1.c1ccc2ncccc2c1 |
| InChI | InChI=1S/C9H7N.2C3H4N2.BH3O3/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-5-3-4-1;2-1(3)4/h1-7H;2*1-3H,(H,4,5);2-4H |
| InChIKey | QVANSVPIQABWEJ-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 130.94 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.15 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze boric acid;bis(1H-imidazole);quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of boric acid;bis(1H-imidazole);quinoline?
The IUPAC name of boric acid;bis(1H-imidazole);quinoline (CID 174795094) is boric acid;bis(1H-imidazole);quinoline.
What is the SMILES notation for boric acid;bis(1H-imidazole);quinoline?
The canonical SMILES for boric acid;bis(1H-imidazole);quinoline is OB(O)O.c1c[nH]cn1.c1c[nH]cn1.c1ccc2ncccc2c1.
What is the InChIKey of boric acid;bis(1H-imidazole);quinoline?
The InChIKey is QVANSVPIQABWEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7N.2C3H4N2.BH3O3/c1-2-6-9-8(4-1)5-3-7-10-9;2*1-2-5-3-4-1;2-1(3)4/h1-7H;2*1-3H,(H,4,5);2-4H.
What are the key properties of boric acid;bis(1H-imidazole);quinoline?
boric acid;bis(1H-imidazole);quinoline has a molecular weight of 327.15 g/mol, XLogP of 1.00, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for boric acid;bis(1H-imidazole);quinoline is sourced from PubChem (CID 174795094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).