C28H26O3S2 — CID 174505823
2-(3,5-dimethylphenyl)-4-[3-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanyloxysulfanylphenol (PubChem CID 174505823) has the molecular formula C28H26O3S2 and a molecular weight of 474.65 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-4-[3-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanyloxysulfanylphenol.
| Compound Name | 2-(3,5-dimethylphenyl)-4-[3-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanyloxysulfanylphenol |
|---|---|
| PubChem CID | 174505823 |
| Molecular Formula | C28H26O3S2 |
| Molecular Weight | 474.65 g/mol |
| Exact Mass | 474.13 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-4-[3-(3,5-dimethylphenyl)-4-hydroxyphenyl]sulfanyloxysulfanylphenol |
| SMILES | Cc1cc(C)cc(-c2cc(SOSc3ccc(O)c(-c4cc(C)cc(C)c4)c3)ccc2O)c1 |
| InChI | InChI=1S/C28H26O3S2/c1-17-9-18(2)12-21(11-17)25-15-23(5-7-27(25)29)32-31-33-24-6-8-28(30)26(16-24)22-13-19(3)10-20(4)14-22/h5-16,29-30H,1-4H3 |
| InChIKey | IUWUSJXOJCNBGL-UHFFFAOYSA-N |
| XLogP | 8.40 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.65 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|