C28H30FN5O — CID 174507817
7-[3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-2H-imidazol-1-yl]-2-phenylquinoline-4-carbonyl fluoride (PubChem CID 174507817) has the molecular formula C28H30FN5O and a molecular weight of 471.58 g/mol. Its IUPAC name is 7-[3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-2H-imidazol-1-yl]-2-phenylquinoline-4-carbonyl fluoride.
| Compound Name | 7-[3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-2H-imidazol-1-yl]-2-phenylquinoline-4-carbonyl fluoride |
|---|---|
| PubChem CID | 174507817 |
| Molecular Formula | C28H30FN5O |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | 7-[3-[3-(4-methylpiperazin-1-yl)cyclobutyl]-2H-imidazol-1-yl]-2-phenylquinoline-4-carbonyl fluoride |
| SMILES | CN1CCN(C2CC(N3C=CN(c4ccc5c(C(=O)F)cc(-c6ccccc6)nc5c4)C3)C2)CC1 |
| InChI | InChI=1S/C28H30FN5O/c1-31-9-11-32(12-10-31)22-15-23(16-22)34-14-13-33(19-34)21-7-8-24-25(28(29)35)18-26(30-27(24)17-21)20-5-3-2-4-6-20/h2-8,13-14,17-18,22-23H,9-12,15-16,19H2,1H3 |
| InChIKey | NBFQHMMYXLMMEL-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 42.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|